C16H14N4 — CID 12610952
4-methyl-N,6-diphenyl-1,3,5-triazin-2-amine (PubChem CID 12610952) has the molecular formula C16H14N4 and a molecular weight of 262.32 g/mol. Its IUPAC name is 4-methyl-N,6-diphenyl-1,3,5-triazin-2-amine.
| Compound Name | 4-methyl-N,6-diphenyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 12610952 |
| Molecular Formula | C16H14N4 |
| Molecular Weight | 262.32 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 4-methyl-N,6-diphenyl-1,3,5-triazin-2-amine |
| SMILES | Cc1nc(Nc2ccccc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C16H14N4/c1-12-17-15(13-8-4-2-5-9-13)20-16(18-12)19-14-10-6-3-7-11-14/h2-11H,1H3,(H,17,18,19,20) |
| InChIKey | FXWKCKCULHUIQE-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.32 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |