C9H17NO2 — CID 12610996
2,2,6,6-tetramethyl-1-oxidopiperidin-1-ium-4-one (PubChem CID 12610996) has the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-1-oxidopiperidin-1-ium-4-one.
| Compound Name | 2,2,6,6-tetramethyl-1-oxidopiperidin-1-ium-4-one |
|---|---|
| PubChem CID | 12610996 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | 2,2,6,6-tetramethyl-1-oxidopiperidin-1-ium-4-one |
| SMILES | CC1(C)CC(=O)CC(C)(C)[NH+]1[O-] |
| InChI | InChI=1S/C9H17NO2/c1-8(2)5-7(11)6-9(3,4)10(8)12/h10H,5-6H2,1-4H3 |
| InChIKey | QCJQZWOBJMCVPS-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 44.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |