About 1-methoxyhepta-1,2-dienyl(trimethyl)silane
1-methoxyhepta-1,2-dienyl(trimethyl)silane (PubChem CID 12611133) has the molecular formula C11H22OSi
and a molecular weight of 198.38 g/mol. Its IUPAC name is 1-methoxyhepta-1,2-dienyl(trimethyl)silane.
Molecular Properties
| Compound Name | 1-methoxyhepta-1,2-dienyl(trimethyl)silane |
| PubChem CID | 12611133 |
| Molecular Formula | C11H22OSi |
| Molecular Weight | 198.38 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 1-methoxyhepta-1,2-dienyl(trimethyl)silane |
| SMILES | CCCCC=C=C(OC)[Si](C)(C)C |
| InChI | InChI=1S/C11H22OSi/c1-6-7-8-9-10-11(12-2)13(3,4)5/h9H,6-8H2,1-5H3 |
| InChIKey | WHWQZRBIFJWTQH-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.38 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxyhepta-1,2-dienyl(trimethyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxyhepta-1,2-dienyl(trimethyl)silane?
The IUPAC name of 1-methoxyhepta-1,2-dienyl(trimethyl)silane (CID 12611133) is 1-methoxyhepta-1,2-dienyl(trimethyl)silane.
What is the SMILES notation for 1-methoxyhepta-1,2-dienyl(trimethyl)silane?
The canonical SMILES for 1-methoxyhepta-1,2-dienyl(trimethyl)silane is CCCCC=C=C(OC)[Si](C)(C)C.
What is the InChIKey of 1-methoxyhepta-1,2-dienyl(trimethyl)silane?
The InChIKey is WHWQZRBIFJWTQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22OSi/c1-6-7-8-9-10-11(12-2)13(3,4)5/h9H,6-8H2,1-5H3.
What are the key properties of 1-methoxyhepta-1,2-dienyl(trimethyl)silane?
1-methoxyhepta-1,2-dienyl(trimethyl)silane has a molecular weight of 198.38 g/mol, XLogP of 3.74, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxyhepta-1,2-dienyl(trimethyl)silane is sourced from PubChem (CID 12611133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).