C19H12N2O4S — CID 126111661
(2Z)-2-[[5-(3-nitrophenyl)furan-2-yl]methylidene]-4H-1,4-benzothiazin-3-one (PubChem CID 126111661) has the molecular formula C19H12N2O4S and a molecular weight of 364.38 g/mol. Its IUPAC name is (2Z)-2-[[5-(3-nitrophenyl)furan-2-yl]methylidene]-4H-1,4-benzothiazin-3-one.
| Compound Name | (2Z)-2-[[5-(3-nitrophenyl)furan-2-yl]methylidene]-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 126111661 |
| Molecular Formula | C19H12N2O4S |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | (2Z)-2-[[5-(3-nitrophenyl)furan-2-yl]methylidene]-4H-1,4-benzothiazin-3-one |
| SMILES | O=C1Nc2ccccc2S/C1=C\c1ccc(-c2cccc([N+](=O)[O-])c2)o1 |
| InChI | InChI=1S/C19H12N2O4S/c22-19-18(26-17-7-2-1-6-15(17)20-19)11-14-8-9-16(25-14)12-4-3-5-13(10-12)21(23)24/h1-11H,(H,20,22)/b18-11- |
| InChIKey | IMOBIHZMPZEOHL-WQRHYEAKSA-N |
| XLogP | 4.94 |
| TPSA | 85.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|