C23H20BrCl2NO6S — CID 126112587
methyl (2R)-2-[(5E)-5-[[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate (PubChem CID 126112587) has the molecular formula C23H20BrCl2NO6S and a molecular weight of 589.29 g/mol. Its IUPAC name is methyl (2R)-2-[(5E)-5-[[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate.
| Compound Name | methyl (2R)-2-[(5E)-5-[[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate |
|---|---|
| PubChem CID | 126112587 |
| Molecular Formula | C23H20BrCl2NO6S |
| Molecular Weight | 589.29 g/mol |
| Exact Mass | 586.96 |
| IUPAC Name | methyl (2R)-2-[(5E)-5-[[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate |
| SMILES | CCOc1cc(/C=C2/SC(=O)N([C@H](C)C(=O)OC)C2=O)cc(Br)c1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H20BrCl2NO6S/c1-4-32-18-9-14(10-19-21(28)27(23(30)34-19)12(2)22(29)31-3)7-15(24)20(18)33-11-13-5-6-16(25)17(26)8-13/h5-10,12H,4,11H2,1-3H3/b19-10+/t12-/m1/s1 |
| InChIKey | MZKBIFXCFOJHGZ-AINDZBIGSA-N |
| XLogP | 6.33 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.29 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|