C22H20BrN3O7 — CID 126113956
2-[5-bromo-2-methoxy-4-[(E)-[1-[2-(3-methylanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetic acid (PubChem CID 126113956) has the molecular formula C22H20BrN3O7 and a molecular weight of 518.32 g/mol. Its IUPAC name is 2-[5-bromo-2-methoxy-4-[(E)-[1-[2-(3-methylanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[5-bromo-2-methoxy-4-[(E)-[1-[2-(3-methylanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 126113956 |
| Molecular Formula | C22H20BrN3O7 |
| Molecular Weight | 518.32 g/mol |
| Exact Mass | 517.05 |
| IUPAC Name | 2-[5-bromo-2-methoxy-4-[(E)-[1-[2-(3-methylanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetic acid |
| SMILES | COc1cc(/C=C2/NC(=O)N(CC(=O)Nc3cccc(C)c3)C2=O)c(Br)cc1OCC(=O)O |
| InChI | InChI=1S/C22H20BrN3O7/c1-12-4-3-5-14(6-12)24-19(27)10-26-21(30)16(25-22(26)31)7-13-8-17(32-2)18(9-15(13)23)33-11-20(28)29/h3-9H,10-11H2,1-2H3,(H,24,27)(H,25,31)(H,28,29)/b16-7+ |
| InChIKey | SFFNWDFLTHDPJC-FRKPEAEDSA-N |
| XLogP | 2.76 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.32 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|