C18H12F2N2O2 — CID 126114448
3-[2-[(2,4-difluorophenyl)iminomethyl]pyrrol-1-yl]benzoic acid (PubChem CID 126114448) has the molecular formula C18H12F2N2O2 and a molecular weight of 326.30 g/mol. Its IUPAC name is 3-[2-[(2,4-difluorophenyl)iminomethyl]pyrrol-1-yl]benzoic acid.
| Compound Name | 3-[2-[(2,4-difluorophenyl)iminomethyl]pyrrol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 126114448 |
| Molecular Formula | C18H12F2N2O2 |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 3-[2-[(2,4-difluorophenyl)iminomethyl]pyrrol-1-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(-n2cccc2/C=N/c2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C18H12F2N2O2/c19-13-6-7-17(16(20)10-13)21-11-15-5-2-8-22(15)14-4-1-3-12(9-14)18(23)24/h1-11H,(H,23,24)/b21-11+ |
| InChIKey | VOAJCWOQMBOTLO-SRZZPIQSSA-N |
| XLogP | 4.20 |
| TPSA | 54.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|