C38H36BrN3O5S — CID 126115511
(2E,5R)-2-[[2-[(4-bromophenyl)methoxy]naphthalen-1-yl]methylidene]-5-(2,5-dimethoxyphenyl)-N,N-diethyl-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide (PubChem CID 126115511) has the molecular formula C38H36BrN3O5S and a molecular weight of 726.69 g/mol. Its IUPAC name is (2E,5R)-2-[[2-[(4-bromophenyl)methoxy]naphthalen-1-yl]methylidene]-5-(2,5-dimethoxyphenyl)-N,N-diethyl-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide.
| Compound Name | (2E,5R)-2-[[2-[(4-bromophenyl)methoxy]naphthalen-1-yl]methylidene]-5-(2,5-dimethoxyphenyl)-N,N-diethyl-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 126115511 |
| Molecular Formula | C38H36BrN3O5S |
| Molecular Weight | 726.69 g/mol |
| Exact Mass | 725.16 |
| IUPAC Name | (2E,5R)-2-[[2-[(4-bromophenyl)methoxy]naphthalen-1-yl]methylidene]-5-(2,5-dimethoxyphenyl)-N,N-diethyl-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
| SMILES | CCN(CC)C(=O)C1=C(C)N=c2s/c(=C/c3c(OCc4ccc(Br)cc4)ccc4ccccc34)c(=O)n2[C@@H]1c1cc(OC)ccc1OC |
| InChI | InChI=1S/C38H36BrN3O5S/c1-6-41(7-2)37(44)34-23(3)40-38-42(35(34)30-20-27(45-4)17-19-31(30)46-5)36(43)33(48-38)21-29-28-11-9-8-10-25(28)14-18-32(29)47-22-24-12-15-26(39)16-13-24/h8-21,35H,6-7,22H2,1-5H3/b33-21+/t35-/m1/s1 |
| InChIKey | ZGVWQKQBUCPBMF-BPOMCQNBSA-N |
| XLogP | 6.62 |
| TPSA | 82.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.69 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |