C9H14O — CID 12611645
4-methyl-2,3,4,5,6,7-hexahydro-1-benzofuran (PubChem CID 12611645) has the molecular formula C9H14O and a molecular weight of 138.21 g/mol. Its IUPAC name is 4-methyl-2,3,4,5,6,7-hexahydro-1-benzofuran.
| Compound Name | 4-methyl-2,3,4,5,6,7-hexahydro-1-benzofuran |
|---|---|
| PubChem CID | 12611645 |
| Molecular Formula | C9H14O |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.10 |
| IUPAC Name | 4-methyl-2,3,4,5,6,7-hexahydro-1-benzofuran |
| SMILES | CC1CCCC2=C1CCO2 |
| InChI | InChI=1S/C9H14O/c1-7-3-2-4-9-8(7)5-6-10-9/h7H,2-6H2,1H3 |
| InChIKey | KEEZDWRNEIIDCX-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |