C24H21IN2O2S — CID 126118506
N-(4-iodophenyl)-4-[(2R)-4-oxo-3-(2-phenylethyl)-1,3-thiazolidin-2-yl]benzamide (PubChem CID 126118506) has the molecular formula C24H21IN2O2S and a molecular weight of 528.42 g/mol. Its IUPAC name is N-(4-iodophenyl)-4-[(2R)-4-oxo-3-(2-phenylethyl)-1,3-thiazolidin-2-yl]benzamide.
| Compound Name | N-(4-iodophenyl)-4-[(2R)-4-oxo-3-(2-phenylethyl)-1,3-thiazolidin-2-yl]benzamide |
|---|---|
| PubChem CID | 126118506 |
| Molecular Formula | C24H21IN2O2S |
| Molecular Weight | 528.42 g/mol |
| Exact Mass | 528.04 |
| IUPAC Name | N-(4-iodophenyl)-4-[(2R)-4-oxo-3-(2-phenylethyl)-1,3-thiazolidin-2-yl]benzamide |
| SMILES | O=C(Nc1ccc(I)cc1)c1ccc([C@H]2SCC(=O)N2CCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H21IN2O2S/c25-20-10-12-21(13-11-20)26-23(29)18-6-8-19(9-7-18)24-27(22(28)16-30-24)15-14-17-4-2-1-3-5-17/h1-13,24H,14-16H2,(H,26,29)/t24-/m1/s1 |
| InChIKey | BGGYOXCLQCDDBC-XMMPIXPASA-N |
| XLogP | 5.36 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.42 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|