C30H30N2O3S — CID 126119642
N,N-dibenzyl-4-[(2-methylphenyl)methyl-methylsulfonylamino]benzamide (PubChem CID 126119642) has the molecular formula C30H30N2O3S and a molecular weight of 498.65 g/mol. Its IUPAC name is N,N-dibenzyl-4-[(2-methylphenyl)methyl-methylsulfonylamino]benzamide.
| Compound Name | N,N-dibenzyl-4-[(2-methylphenyl)methyl-methylsulfonylamino]benzamide |
|---|---|
| PubChem CID | 126119642 |
| Molecular Formula | C30H30N2O3S |
| Molecular Weight | 498.65 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | N,N-dibenzyl-4-[(2-methylphenyl)methyl-methylsulfonylamino]benzamide |
| SMILES | Cc1ccccc1CN(c1ccc(C(=O)N(Cc2ccccc2)Cc2ccccc2)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C30H30N2O3S/c1-24-11-9-10-16-28(24)23-32(36(2,34)35)29-19-17-27(18-20-29)30(33)31(21-25-12-5-3-6-13-25)22-26-14-7-4-8-15-26/h3-20H,21-23H2,1-2H3 |
| InChIKey | FMTQFMWFLVKETF-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.65 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |