C31H29ClN4O4S — CID 126121374
N-[3-[(Z)-N-[[2-(N-(4-chlorophenyl)sulfonyl-3,4-dimethylanilino)acetyl]amino]-C-methylcarbonimidoyl]phenyl]benzamide (PubChem CID 126121374) has the molecular formula C31H29ClN4O4S and a molecular weight of 589.12 g/mol. Its IUPAC name is N-[3-[(Z)-N-[[2-(N-(4-chlorophenyl)sulfonyl-3,4-dimethylanilino)acetyl]amino]-C-methylcarbonimidoyl]phenyl]benzamide.
| Compound Name | N-[3-[(Z)-N-[[2-(N-(4-chlorophenyl)sulfonyl-3,4-dimethylanilino)acetyl]amino]-C-methylcarbonimidoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 126121374 |
| Molecular Formula | C31H29ClN4O4S |
| Molecular Weight | 589.12 g/mol |
| Exact Mass | 588.16 |
| IUPAC Name | N-[3-[(Z)-N-[[2-(N-(4-chlorophenyl)sulfonyl-3,4-dimethylanilino)acetyl]amino]-C-methylcarbonimidoyl]phenyl]benzamide |
| SMILES | C/C(=N/NC(=O)CN(c1ccc(C)c(C)c1)S(=O)(=O)c1ccc(Cl)cc1)c1cccc(NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C31H29ClN4O4S/c1-21-12-15-28(18-22(21)2)36(41(39,40)29-16-13-26(32)14-17-29)20-30(37)35-34-23(3)25-10-7-11-27(19-25)33-31(38)24-8-5-4-6-9-24/h4-19H,20H2,1-3H3,(H,33,38)(H,35,37)/b34-23- |
| InChIKey | GTCKOKFVKYRUBD-XSVYLIDLSA-N |
| XLogP | 5.94 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.12 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|