C25H16ClN5O3 — CID 12612425
2-[(8-chloro-6-phenyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-1-yl)methoxy]isoindole-1,3-dione (PubChem CID 12612425) has the molecular formula C25H16ClN5O3 and a molecular weight of 469.89 g/mol. Its IUPAC name is 2-[(8-chloro-6-phenyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-1-yl)methoxy]isoindole-1,3-dione.
| Compound Name | 2-[(8-chloro-6-phenyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-1-yl)methoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 12612425 |
| Molecular Formula | C25H16ClN5O3 |
| Molecular Weight | 469.89 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | 2-[(8-chloro-6-phenyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-1-yl)methoxy]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1OCc1nnc2n1-c1ccc(Cl)cc1C(c1ccccc1)=NC2 |
| InChI | InChI=1S/C25H16ClN5O3/c26-16-10-11-20-19(12-16)23(15-6-2-1-3-7-15)27-13-21-28-29-22(30(20)21)14-34-31-24(32)17-8-4-5-9-18(17)25(31)33/h1-12H,13-14H2 |
| InChIKey | ZIWSEWQGOZACQP-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 89.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.89 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|