C23H22IN3O3S — CID 126124709
N-[(Z)-1-(3-iodophenyl)ethylideneamino]-4-[methyl-(4-methylphenyl)sulfonylamino]benzamide (PubChem CID 126124709) has the molecular formula C23H22IN3O3S and a molecular weight of 547.42 g/mol. Its IUPAC name is N-[(Z)-1-(3-iodophenyl)ethylideneamino]-4-[methyl-(4-methylphenyl)sulfonylamino]benzamide.
| Compound Name | N-[(Z)-1-(3-iodophenyl)ethylideneamino]-4-[methyl-(4-methylphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 126124709 |
| Molecular Formula | C23H22IN3O3S |
| Molecular Weight | 547.42 g/mol |
| Exact Mass | 547.04 |
| IUPAC Name | N-[(Z)-1-(3-iodophenyl)ethylideneamino]-4-[methyl-(4-methylphenyl)sulfonylamino]benzamide |
| SMILES | C/C(=N/NC(=O)c1ccc(N(C)S(=O)(=O)c2ccc(C)cc2)cc1)c1cccc(I)c1 |
| InChI | InChI=1S/C23H22IN3O3S/c1-16-7-13-22(14-8-16)31(29,30)27(3)21-11-9-18(10-12-21)23(28)26-25-17(2)19-5-4-6-20(24)15-19/h4-15H,1-3H3,(H,26,28)/b25-17- |
| InChIKey | PYYLWNUAJOVOGT-UQQQWYQISA-N |
| XLogP | 4.58 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.42 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|