C19H20ClN3O — CID 12612536
7-chloro-2-(diethylamino)-5-phenyl-3H-1,4-benzodiazepin-3-ol (PubChem CID 12612536) has the molecular formula C19H20ClN3O and a molecular weight of 341.84 g/mol. Its IUPAC name is 7-chloro-2-(diethylamino)-5-phenyl-3H-1,4-benzodiazepin-3-ol.
| Compound Name | 7-chloro-2-(diethylamino)-5-phenyl-3H-1,4-benzodiazepin-3-ol |
|---|---|
| PubChem CID | 12612536 |
| Molecular Formula | C19H20ClN3O |
| Molecular Weight | 341.84 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 7-chloro-2-(diethylamino)-5-phenyl-3H-1,4-benzodiazepin-3-ol |
| SMILES | CCN(CC)C1=Nc2ccc(Cl)cc2C(c2ccccc2)=NC1O |
| InChI | InChI=1S/C19H20ClN3O/c1-3-23(4-2)18-19(24)22-17(13-8-6-5-7-9-13)15-12-14(20)10-11-16(15)21-18/h5-12,19,24H,3-4H2,1-2H3 |
| InChIKey | SFVRXPFSPMIJOP-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 48.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.84 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |