C21H18Cl2N2O3 — CID 126125539
N-[[3,5-dichloro-4-[(4-nitrophenyl)methoxy]phenyl]methyl]-2-methylaniline (PubChem CID 126125539) has the molecular formula C21H18Cl2N2O3 and a molecular weight of 417.29 g/mol. Its IUPAC name is N-[[3,5-dichloro-4-[(4-nitrophenyl)methoxy]phenyl]methyl]-2-methylaniline.
| Compound Name | N-[[3,5-dichloro-4-[(4-nitrophenyl)methoxy]phenyl]methyl]-2-methylaniline |
|---|---|
| PubChem CID | 126125539 |
| Molecular Formula | C21H18Cl2N2O3 |
| Molecular Weight | 417.29 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | N-[[3,5-dichloro-4-[(4-nitrophenyl)methoxy]phenyl]methyl]-2-methylaniline |
| SMILES | Cc1ccccc1NCc1cc(Cl)c(OCc2ccc([N+](=O)[O-])cc2)c(Cl)c1 |
| InChI | InChI=1S/C21H18Cl2N2O3/c1-14-4-2-3-5-20(14)24-12-16-10-18(22)21(19(23)11-16)28-13-15-6-8-17(9-7-15)25(26)27/h2-11,24H,12-13H2,1H3 |
| InChIKey | RTKCHIPPBKZXSH-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.29 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|