C12H17N3O3 — CID 12612564
1,3-bis(prop-2-enyl)-5-propyl-1,3,5-triazinane-2,4,6-trione (PubChem CID 12612564) has the molecular formula C12H17N3O3 and a molecular weight of 251.29 g/mol. Its IUPAC name is 1,3-bis(prop-2-enyl)-5-propyl-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3-bis(prop-2-enyl)-5-propyl-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 12612564 |
| Molecular Formula | C12H17N3O3 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 1,3-bis(prop-2-enyl)-5-propyl-1,3,5-triazinane-2,4,6-trione |
| SMILES | C=CCn1c(=O)n(CC=C)c(=O)n(CCC)c1=O |
| InChI | InChI=1S/C12H17N3O3/c1-4-7-13-10(16)14(8-5-2)12(18)15(9-6-3)11(13)17/h4-5H,1-2,6-9H2,3H3 |
| InChIKey | ZIJDEADTCQKATN-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 66.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|