C18H19NO — CID 126126586
2,4-dimethyl-N-[(3-prop-2-ynoxyphenyl)methyl]aniline (PubChem CID 126126586) has the molecular formula C18H19NO and a molecular weight of 265.36 g/mol. Its IUPAC name is 2,4-dimethyl-N-[(3-prop-2-ynoxyphenyl)methyl]aniline.
| Compound Name | 2,4-dimethyl-N-[(3-prop-2-ynoxyphenyl)methyl]aniline |
|---|---|
| PubChem CID | 126126586 |
| Molecular Formula | C18H19NO |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 2,4-dimethyl-N-[(3-prop-2-ynoxyphenyl)methyl]aniline |
| SMILES | C#CCOc1cccc(CNc2ccc(C)cc2C)c1 |
| InChI | InChI=1S/C18H19NO/c1-4-10-20-17-7-5-6-16(12-17)13-19-18-9-8-14(2)11-15(18)3/h1,5-9,11-12,19H,10,13H2,2-3H3 |
| InChIKey | WBWKILWTRYGUPP-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|