C21H19BrClNO — CID 126127108
N-[[3-[(4-bromophenyl)methoxy]phenyl]methyl]-5-chloro-2-methylaniline (PubChem CID 126127108) has the molecular formula C21H19BrClNO and a molecular weight of 416.75 g/mol. Its IUPAC name is N-[[3-[(4-bromophenyl)methoxy]phenyl]methyl]-5-chloro-2-methylaniline.
| Compound Name | N-[[3-[(4-bromophenyl)methoxy]phenyl]methyl]-5-chloro-2-methylaniline |
|---|---|
| PubChem CID | 126127108 |
| Molecular Formula | C21H19BrClNO |
| Molecular Weight | 416.75 g/mol |
| Exact Mass | 415.03 |
| IUPAC Name | N-[[3-[(4-bromophenyl)methoxy]phenyl]methyl]-5-chloro-2-methylaniline |
| SMILES | Cc1ccc(Cl)cc1NCc1cccc(OCc2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C21H19BrClNO/c1-15-5-10-19(23)12-21(15)24-13-17-3-2-4-20(11-17)25-14-16-6-8-18(22)9-7-16/h2-12,24H,13-14H2,1H3 |
| InChIKey | UFAKASSMXPDCFN-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.75 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |