About 4-dipropoxyphosphoryl-2,6-diphenylthian-4-ol
4-dipropoxyphosphoryl-2,6-diphenylthian-4-ol (PubChem CID 12612853) has the molecular formula C23H31O4PS
and a molecular weight of 434.54 g/mol. Its IUPAC name is 4-dipropoxyphosphoryl-2,6-diphenylthian-4-ol.
Molecular Properties
| Compound Name | 4-dipropoxyphosphoryl-2,6-diphenylthian-4-ol |
| PubChem CID | 12612853 |
| Molecular Formula | C23H31O4PS |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 4-dipropoxyphosphoryl-2,6-diphenylthian-4-ol |
| SMILES | CCCOP(=O)(OCCC)C1(O)CC(c2ccccc2)SC(c2ccccc2)C1 |
| InChI | InChI=1S/C23H31O4PS/c1-3-15-26-28(25,27-16-4-2)23(24)17-21(19-11-7-5-8-12-19)29-22(18-23)20-13-9-6-10-14-20/h5-14,21-22,24H,3-4,15-18H2,1-2H3 |
| InChIKey | QQYFZDCRXMTKSZ-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-dipropoxyphosphoryl-2,6-diphenylthian-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-dipropoxyphosphoryl-2,6-diphenylthian-4-ol?
The IUPAC name of 4-dipropoxyphosphoryl-2,6-diphenylthian-4-ol (CID 12612853) is 4-dipropoxyphosphoryl-2,6-diphenylthian-4-ol.
What is the SMILES notation for 4-dipropoxyphosphoryl-2,6-diphenylthian-4-ol?
The canonical SMILES for 4-dipropoxyphosphoryl-2,6-diphenylthian-4-ol is CCCOP(=O)(OCCC)C1(O)CC(c2ccccc2)SC(c2ccccc2)C1.
What is the InChIKey of 4-dipropoxyphosphoryl-2,6-diphenylthian-4-ol?
The InChIKey is QQYFZDCRXMTKSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H31O4PS/c1-3-15-26-28(25,27-16-4-2)23(24)17-21(19-11-7-5-8-12-19)29-22(18-23)20-13-9-6-10-14-20/h5-14,21-22,24H,3-4,15-18H2,1-2H3.
What are the key properties of 4-dipropoxyphosphoryl-2,6-diphenylthian-4-ol?
4-dipropoxyphosphoryl-2,6-diphenylthian-4-ol has a molecular weight of 434.54 g/mol, XLogP of 6.73, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-dipropoxyphosphoryl-2,6-diphenylthian-4-ol is sourced from PubChem (CID 12612853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).