C24H20F3N3O4S2 — CID 126128689
3-(4-methoxyphenyl)-5-methyl-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-6-propylthieno[2,3-d]pyrimidin-4-one (PubChem CID 126128689) has the molecular formula C24H20F3N3O4S2 and a molecular weight of 535.57 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-5-methyl-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-6-propylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-(4-methoxyphenyl)-5-methyl-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-6-propylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 126128689 |
| Molecular Formula | C24H20F3N3O4S2 |
| Molecular Weight | 535.57 g/mol |
| Exact Mass | 535.08 |
| IUPAC Name | 3-(4-methoxyphenyl)-5-methyl-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-6-propylthieno[2,3-d]pyrimidin-4-one |
| SMILES | CCCc1sc2nc(Sc3ccc(C(F)(F)F)cc3[N+](=O)[O-])n(-c3ccc(OC)cc3)c(=O)c2c1C |
| InChI | InChI=1S/C24H20F3N3O4S2/c1-4-5-18-13(2)20-21(35-18)28-23(29(22(20)31)15-7-9-16(34-3)10-8-15)36-19-11-6-14(24(25,26)27)12-17(19)30(32)33/h6-12H,4-5H2,1-3H3 |
| InChIKey | XJTIEKHSGDLYGD-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.57 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|