C19H11Cl2I2NO5S — CID 126128955
2-[(5E)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 126128955) has the molecular formula C19H11Cl2I2NO5S and a molecular weight of 690.08 g/mol. Its IUPAC name is 2-[(5E)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[(5E)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 126128955 |
| Molecular Formula | C19H11Cl2I2NO5S |
| Molecular Weight | 690.08 g/mol |
| Exact Mass | 688.78 |
| IUPAC Name | 2-[(5E)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)S/C(=C/c2cc(I)c(OCc3ccc(Cl)cc3Cl)c(I)c2)C1=O |
| InChI | InChI=1S/C19H11Cl2I2NO5S/c20-11-2-1-10(12(21)6-11)8-29-17-13(22)3-9(4-14(17)23)5-15-18(27)24(7-16(25)26)19(28)30-15/h1-6H,7-8H2,(H,25,26)/b15-5+ |
| InChIKey | ALWHATAPHIJGCY-PJQLUOCWSA-N |
| XLogP | 5.90 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.08 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|