C24H29N3O4 — CID 126130235
(3S)-1-[4-[2-(4-ethylanilino)-2-oxoethoxy]phenyl]-5-oxo-N-propylpyrrolidine-3-carboxamide (PubChem CID 126130235) has the molecular formula C24H29N3O4 and a molecular weight of 423.51 g/mol. Its IUPAC name is (3S)-1-[4-[2-(4-ethylanilino)-2-oxoethoxy]phenyl]-5-oxo-N-propylpyrrolidine-3-carboxamide.
| Compound Name | (3S)-1-[4-[2-(4-ethylanilino)-2-oxoethoxy]phenyl]-5-oxo-N-propylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 126130235 |
| Molecular Formula | C24H29N3O4 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | (3S)-1-[4-[2-(4-ethylanilino)-2-oxoethoxy]phenyl]-5-oxo-N-propylpyrrolidine-3-carboxamide |
| SMILES | CCCNC(=O)[C@H]1CC(=O)N(c2ccc(OCC(=O)Nc3ccc(CC)cc3)cc2)C1 |
| InChI | InChI=1S/C24H29N3O4/c1-3-13-25-24(30)18-14-23(29)27(15-18)20-9-11-21(12-10-20)31-16-22(28)26-19-7-5-17(4-2)6-8-19/h5-12,18H,3-4,13-16H2,1-2H3,(H,25,30)(H,26,28)/t18-/m0/s1 |
| InChIKey | FXBGIAFAMWDLMC-SFHVURJKSA-N |
| XLogP | 3.15 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |