C31H28BrN3O4S — CID 126130522
methyl 2-[(5Z)-5-[[1-(4-bromonaphthalen-1-yl)-2,5-dimethylpyrrol-3-yl]methylidene]-3-(4-ethoxyphenyl)-4-oxo-2-sulfanylideneimidazolidin-1-yl]acetate (PubChem CID 126130522) has the molecular formula C31H28BrN3O4S and a molecular weight of 618.55 g/mol. Its IUPAC name is methyl 2-[(5Z)-5-[[1-(4-bromonaphthalen-1-yl)-2,5-dimethylpyrrol-3-yl]methylidene]-3-(4-ethoxyphenyl)-4-oxo-2-sulfanylideneimidazolidin-1-yl]acetate.
| Compound Name | methyl 2-[(5Z)-5-[[1-(4-bromonaphthalen-1-yl)-2,5-dimethylpyrrol-3-yl]methylidene]-3-(4-ethoxyphenyl)-4-oxo-2-sulfanylideneimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 126130522 |
| Molecular Formula | C31H28BrN3O4S |
| Molecular Weight | 618.55 g/mol |
| Exact Mass | 617.10 |
| IUPAC Name | methyl 2-[(5Z)-5-[[1-(4-bromonaphthalen-1-yl)-2,5-dimethylpyrrol-3-yl]methylidene]-3-(4-ethoxyphenyl)-4-oxo-2-sulfanylideneimidazolidin-1-yl]acetate |
| SMILES | CCOc1ccc(N2C(=O)/C(=C/c3cc(C)n(-c4ccc(Br)c5ccccc45)c3C)N(CC(=O)OC)C2=S)cc1 |
| InChI | InChI=1S/C31H28BrN3O4S/c1-5-39-23-12-10-22(11-13-23)35-30(37)28(33(31(35)40)18-29(36)38-4)17-21-16-19(2)34(20(21)3)27-15-14-26(32)24-8-6-7-9-25(24)27/h6-17H,5,18H2,1-4H3/b28-17- |
| InChIKey | AIILAFBTZJBUGP-QRQIAZFYSA-N |
| XLogP | 6.56 |
| TPSA | 64.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.55 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_F(8)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|