C25H21BrClN3O2S — CID 126131131
(5E)-5-[[1-(4-bromo-3-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1-(2,3-dimethylphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 126131131) has the molecular formula C25H21BrClN3O2S and a molecular weight of 542.89 g/mol. Its IUPAC name is (5E)-5-[[1-(4-bromo-3-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1-(2,3-dimethylphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | (5E)-5-[[1-(4-bromo-3-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1-(2,3-dimethylphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 126131131 |
| Molecular Formula | C25H21BrClN3O2S |
| Molecular Weight | 542.89 g/mol |
| Exact Mass | 541.02 |
| IUPAC Name | (5E)-5-[[1-(4-bromo-3-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1-(2,3-dimethylphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | Cc1cccc(N2C(=O)/C(=C/c3cc(C)n(-c4ccc(Br)c(Cl)c4)c3C)C(=O)NC2=S)c1C |
| InChI | InChI=1S/C25H21BrClN3O2S/c1-13-6-5-7-22(15(13)3)30-24(32)19(23(31)28-25(30)33)11-17-10-14(2)29(16(17)4)18-8-9-20(26)21(27)12-18/h5-12H,1-4H3,(H,28,31,33)/b19-11+ |
| InChIKey | CSHQAZNHJYMAEF-YBFXNURJSA-N |
| XLogP | 5.96 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.89 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|