C20H30N2O — CID 12613130
2-(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)-2-(diethylamino)acetonitrile (PubChem CID 12613130) has the molecular formula C20H30N2O and a molecular weight of 314.47 g/mol. Its IUPAC name is 2-(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)-2-(diethylamino)acetonitrile.
| Compound Name | 2-(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)-2-(diethylamino)acetonitrile |
|---|---|
| PubChem CID | 12613130 |
| Molecular Formula | C20H30N2O |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.24 |
| IUPAC Name | 2-(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)-2-(diethylamino)acetonitrile |
| SMILES | CCN(CC)C(C#N)=C1C=C(C(C)(C)C)C(=O)C(C(C)(C)C)=C1 |
| InChI | InChI=1S/C20H30N2O/c1-9-22(10-2)17(13-21)14-11-15(19(3,4)5)18(23)16(12-14)20(6,7)8/h11-12H,9-10H2,1-8H3 |
| InChIKey | OCRIQWXYAWLLIP-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|