C31H27FN2O5S — CID 126131742
(5Z)-3-[2-(4-fluorophenoxy)ethyl]-5-[[1-[4-(4-methoxyphenoxy)phenyl]-2,5-dimethylpyrrol-3-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 126131742) has the molecular formula C31H27FN2O5S and a molecular weight of 558.63 g/mol. Its IUPAC name is (5Z)-3-[2-(4-fluorophenoxy)ethyl]-5-[[1-[4-(4-methoxyphenoxy)phenyl]-2,5-dimethylpyrrol-3-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-[2-(4-fluorophenoxy)ethyl]-5-[[1-[4-(4-methoxyphenoxy)phenyl]-2,5-dimethylpyrrol-3-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126131742 |
| Molecular Formula | C31H27FN2O5S |
| Molecular Weight | 558.63 g/mol |
| Exact Mass | 558.16 |
| IUPAC Name | (5Z)-3-[2-(4-fluorophenoxy)ethyl]-5-[[1-[4-(4-methoxyphenoxy)phenyl]-2,5-dimethylpyrrol-3-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1ccc(Oc2ccc(-n3c(C)cc(/C=C4\SC(=O)N(CCOc5ccc(F)cc5)C4=O)c3C)cc2)cc1 |
| InChI | InChI=1S/C31H27FN2O5S/c1-20-18-22(19-29-30(35)33(31(36)40-29)16-17-38-26-8-4-23(32)5-9-26)21(2)34(20)24-6-10-27(11-7-24)39-28-14-12-25(37-3)13-15-28/h4-15,18-19H,16-17H2,1-3H3/b29-19- |
| InChIKey | MKBXHBCJIJGHHA-CEUNXORHSA-N |
| XLogP | 7.15 |
| TPSA | 70.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.63 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|