C10HF15S — CID 12613215
2,3,4,5,6-pentakis(trifluoromethyl)-2H-thiopyran (PubChem CID 12613215) has the molecular formula C10HF15S and a molecular weight of 438.16 g/mol. Its IUPAC name is 2,3,4,5,6-pentakis(trifluoromethyl)-2H-thiopyran.
| Compound Name | 2,3,4,5,6-pentakis(trifluoromethyl)-2H-thiopyran |
|---|---|
| PubChem CID | 12613215 |
| Molecular Formula | C10HF15S |
| Molecular Weight | 438.16 g/mol |
| Exact Mass | 437.96 |
| IUPAC Name | 2,3,4,5,6-pentakis(trifluoromethyl)-2H-thiopyran |
| SMILES | FC(F)(F)C1=C(C(F)(F)F)C(C(F)(F)F)=C(C(F)(F)F)C(C(F)(F)F)S1 |
| InChI | InChI=1S/C10HF15S/c11-6(12,13)1-2(7(14,15)16)4(9(20,21)22)26-5(10(23,24)25)3(1)8(17,18)19/h4H |
| InChIKey | RIZSZNDEDJPLPF-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.16 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |