C22H28INO4S — CID 126132171
(5E)-3-(cyclohexylmethyl)-5-[(3-ethoxy-5-iodo-4-propan-2-yloxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 126132171) has the molecular formula C22H28INO4S and a molecular weight of 529.44 g/mol. Its IUPAC name is (5E)-3-(cyclohexylmethyl)-5-[(3-ethoxy-5-iodo-4-propan-2-yloxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-3-(cyclohexylmethyl)-5-[(3-ethoxy-5-iodo-4-propan-2-yloxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126132171 |
| Molecular Formula | C22H28INO4S |
| Molecular Weight | 529.44 g/mol |
| Exact Mass | 529.08 |
| IUPAC Name | (5E)-3-(cyclohexylmethyl)-5-[(3-ethoxy-5-iodo-4-propan-2-yloxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CCOc1cc(/C=C2/SC(=O)N(CC3CCCCC3)C2=O)cc(I)c1OC(C)C |
| InChI | InChI=1S/C22H28INO4S/c1-4-27-18-11-16(10-17(23)20(18)28-14(2)3)12-19-21(25)24(22(26)29-19)13-15-8-6-5-7-9-15/h10-12,14-15H,4-9,13H2,1-3H3/b19-12+ |
| InChIKey | GBTOIIBTMXZRTP-XDHOZWIPSA-N |
| XLogP | 6.09 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.44 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|