C29H26N2O3S2 — CID 126133171
(5Z)-5-[[1-[2-(2-methoxyphenoxy)ethyl]indol-3-yl]methylidene]-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126133171) has the molecular formula C29H26N2O3S2 and a molecular weight of 514.67 g/mol. Its IUPAC name is (5Z)-5-[[1-[2-(2-methoxyphenoxy)ethyl]indol-3-yl]methylidene]-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[1-[2-(2-methoxyphenoxy)ethyl]indol-3-yl]methylidene]-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126133171 |
| Molecular Formula | C29H26N2O3S2 |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | (5Z)-5-[[1-[2-(2-methoxyphenoxy)ethyl]indol-3-yl]methylidene]-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COc1ccccc1OCCn1cc(/C=C2\SC(=S)N(CCc3ccccc3)C2=O)c2ccccc21 |
| InChI | InChI=1S/C29H26N2O3S2/c1-33-25-13-7-8-14-26(25)34-18-17-30-20-22(23-11-5-6-12-24(23)30)19-27-28(32)31(29(35)36-27)16-15-21-9-3-2-4-10-21/h2-14,19-20H,15-18H2,1H3/b27-19- |
| InChIKey | GENUAJICCBZYDX-DIBXZPPDSA-N |
| XLogP | 6.17 |
| TPSA | 43.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|