C23H21NO4S — CID 126133888
(5E)-5-[(3-methoxy-4-prop-2-ynoxyphenyl)methylidene]-3-(3-phenylpropyl)-1,3-thiazolidine-2,4-dione (PubChem CID 126133888) has the molecular formula C23H21NO4S and a molecular weight of 407.49 g/mol. Its IUPAC name is (5E)-5-[(3-methoxy-4-prop-2-ynoxyphenyl)methylidene]-3-(3-phenylpropyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[(3-methoxy-4-prop-2-ynoxyphenyl)methylidene]-3-(3-phenylpropyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126133888 |
| Molecular Formula | C23H21NO4S |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | (5E)-5-[(3-methoxy-4-prop-2-ynoxyphenyl)methylidene]-3-(3-phenylpropyl)-1,3-thiazolidine-2,4-dione |
| SMILES | C#CCOc1ccc(/C=C2/SC(=O)N(CCCc3ccccc3)C2=O)cc1OC |
| InChI | InChI=1S/C23H21NO4S/c1-3-14-28-19-12-11-18(15-20(19)27-2)16-21-22(25)24(23(26)29-21)13-7-10-17-8-5-4-6-9-17/h1,4-6,8-9,11-12,15-16H,7,10,13-14H2,2H3/b21-16+ |
| InChIKey | OCFIXIVQRGMVHT-LTGZKZEYSA-N |
| XLogP | 4.38 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|