C7H6F10 — CID 12613476
1,1,1,2,2,5,5,6,6,6-decafluoro-3-methylhexane (PubChem CID 12613476) has the molecular formula C7H6F10 and a molecular weight of 280.11 g/mol. Its IUPAC name is 1,1,1,2,2,5,5,6,6,6-decafluoro-3-methylhexane.
| Compound Name | 1,1,1,2,2,5,5,6,6,6-decafluoro-3-methylhexane |
|---|---|
| PubChem CID | 12613476 |
| Molecular Formula | C7H6F10 |
| Molecular Weight | 280.11 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 1,1,1,2,2,5,5,6,6,6-decafluoro-3-methylhexane |
| SMILES | CC(CC(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H6F10/c1-3(5(10,11)7(15,16)17)2-4(8,9)6(12,13)14/h3H,2H2,1H3 |
| InChIKey | OAOIBSFNOBZDOY-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.11 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|