C15H26N2O5S — CID 12613551
butyl 4-[(2-ethoxy-2-oxoethyl)carbamoyl]-5,5-dimethyl-1,3-thiazolidine-2-carboxylate (PubChem CID 12613551) has the molecular formula C15H26N2O5S and a molecular weight of 346.45 g/mol. Its IUPAC name is butyl 4-[(2-ethoxy-2-oxoethyl)carbamoyl]-5,5-dimethyl-1,3-thiazolidine-2-carboxylate.
| Compound Name | butyl 4-[(2-ethoxy-2-oxoethyl)carbamoyl]-5,5-dimethyl-1,3-thiazolidine-2-carboxylate |
|---|---|
| PubChem CID | 12613551 |
| Molecular Formula | C15H26N2O5S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | butyl 4-[(2-ethoxy-2-oxoethyl)carbamoyl]-5,5-dimethyl-1,3-thiazolidine-2-carboxylate |
| SMILES | CCCCOC(=O)C1NC(C(=O)NCC(=O)OCC)C(C)(C)S1 |
| InChI | InChI=1S/C15H26N2O5S/c1-5-7-8-22-14(20)13-17-11(15(3,4)23-13)12(19)16-9-10(18)21-6-2/h11,13,17H,5-9H2,1-4H3,(H,16,19) |
| InChIKey | KPMVJSOXZHIEDJ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|