About 2,4,9-trimethylcarbazole
2,4,9-trimethylcarbazole (PubChem CID 12613661) has the molecular formula C15H15N
and a molecular weight of 209.29 g/mol. Its IUPAC name is 2,4,9-trimethylcarbazole.
Molecular Properties
| Compound Name | 2,4,9-trimethylcarbazole |
| PubChem CID | 12613661 |
| Molecular Formula | C15H15N |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 2,4,9-trimethylcarbazole |
| SMILES | Cc1cc(C)c2c3ccccc3n(C)c2c1 |
| InChI | InChI=1S/C15H15N/c1-10-8-11(2)15-12-6-4-5-7-13(12)16(3)14(15)9-10/h4-9H,1-3H3 |
| InChIKey | QPUVBMFPOMRCIU-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,4,9-trimethylcarbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4,9-trimethylcarbazole?
The IUPAC name of 2,4,9-trimethylcarbazole (CID 12613661) is 2,4,9-trimethylcarbazole.
What is the SMILES notation for 2,4,9-trimethylcarbazole?
The canonical SMILES for 2,4,9-trimethylcarbazole is Cc1cc(C)c2c3ccccc3n(C)c2c1.
What is the InChIKey of 2,4,9-trimethylcarbazole?
The InChIKey is QPUVBMFPOMRCIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N/c1-10-8-11(2)15-12-6-4-5-7-13(12)16(3)14(15)9-10/h4-9H,1-3H3.
What are the key properties of 2,4,9-trimethylcarbazole?
2,4,9-trimethylcarbazole has a molecular weight of 209.29 g/mol, XLogP of 3.95, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,9-trimethylcarbazole is sourced from PubChem (CID 12613661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).