C14H13IN2O3 — CID 126137128
(5E)-5-[(3-iodo-4-methoxyphenyl)methylidene]-3-prop-2-enylimidazolidine-2,4-dione (PubChem CID 126137128) has the molecular formula C14H13IN2O3 and a molecular weight of 384.17 g/mol. Its IUPAC name is (5E)-5-[(3-iodo-4-methoxyphenyl)methylidene]-3-prop-2-enylimidazolidine-2,4-dione.
| Compound Name | (5E)-5-[(3-iodo-4-methoxyphenyl)methylidene]-3-prop-2-enylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126137128 |
| Molecular Formula | C14H13IN2O3 |
| Molecular Weight | 384.17 g/mol |
| Exact Mass | 384.00 |
| IUPAC Name | (5E)-5-[(3-iodo-4-methoxyphenyl)methylidene]-3-prop-2-enylimidazolidine-2,4-dione |
| SMILES | C=CCN1C(=O)N/C(=C/c2ccc(OC)c(I)c2)C1=O |
| InChI | InChI=1S/C14H13IN2O3/c1-3-6-17-13(18)11(16-14(17)19)8-9-4-5-12(20-2)10(15)7-9/h3-5,7-8H,1,6H2,2H3,(H,16,19)/b11-8+ |
| InChIKey | NPIVCHZWCUQTEY-DHZHZOJOSA-N |
| XLogP | 2.38 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.17 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|