C11H17N2O2+ — CID 12613883
dimethyl-(2,4,6-trimethyl-4-nitrocyclohexa-2,5-dien-1-ylidene)azanium (PubChem CID 12613883) has the molecular formula C11H17N2O2+ and a molecular weight of 209.27 g/mol. Its IUPAC name is dimethyl-(2,4,6-trimethyl-4-nitrocyclohexa-2,5-dien-1-ylidene)azanium.
| Compound Name | dimethyl-(2,4,6-trimethyl-4-nitrocyclohexa-2,5-dien-1-ylidene)azanium |
|---|---|
| PubChem CID | 12613883 |
| Molecular Formula | C11H17N2O2+ |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | dimethyl-(2,4,6-trimethyl-4-nitrocyclohexa-2,5-dien-1-ylidene)azanium |
| SMILES | CC1=CC(C)([N+](=O)[O-])C=C(C)C1=[N+](C)C |
| InChI | InChI=1S/C11H17N2O2/c1-8-6-11(3,13(14)15)7-9(2)10(8)12(4)5/h6-7H,1-5H3/q+1 |
| InChIKey | VDTMMZMKRMLRCG-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|