C9H14O — CID 12614030
4-methoxy-1,2-dimethylcyclohexa-1,4-diene (PubChem CID 12614030) has the molecular formula C9H14O and a molecular weight of 138.21 g/mol. Its IUPAC name is 4-methoxy-1,2-dimethylcyclohexa-1,4-diene.
| Compound Name | 4-methoxy-1,2-dimethylcyclohexa-1,4-diene |
|---|---|
| PubChem CID | 12614030 |
| Molecular Formula | C9H14O |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.10 |
| IUPAC Name | 4-methoxy-1,2-dimethylcyclohexa-1,4-diene |
| SMILES | COC1=CCC(C)=C(C)C1 |
| InChI | InChI=1S/C9H14O/c1-7-4-5-9(10-3)6-8(7)2/h5H,4,6H2,1-3H3 |
| InChIKey | KSUKHOXOUDHEAP-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|