C24H23N3O5S — CID 126141253
methyl (3R,4R)-5-cyano-6-[2-(4-ethoxyanilino)-2-oxoethyl]sulfanyl-2-oxo-4-phenyl-3,4-dihydro-1H-pyridine-3-carboxylate (PubChem CID 126141253) has the molecular formula C24H23N3O5S and a molecular weight of 465.53 g/mol. Its IUPAC name is methyl (3R,4R)-5-cyano-6-[2-(4-ethoxyanilino)-2-oxoethyl]sulfanyl-2-oxo-4-phenyl-3,4-dihydro-1H-pyridine-3-carboxylate.
| Compound Name | methyl (3R,4R)-5-cyano-6-[2-(4-ethoxyanilino)-2-oxoethyl]sulfanyl-2-oxo-4-phenyl-3,4-dihydro-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 126141253 |
| Molecular Formula | C24H23N3O5S |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | methyl (3R,4R)-5-cyano-6-[2-(4-ethoxyanilino)-2-oxoethyl]sulfanyl-2-oxo-4-phenyl-3,4-dihydro-1H-pyridine-3-carboxylate |
| SMILES | CCOc1ccc(NC(=O)CSC2=C(C#N)[C@@H](c3ccccc3)[C@@H](C(=O)OC)C(=O)N2)cc1 |
| InChI | InChI=1S/C24H23N3O5S/c1-3-32-17-11-9-16(10-12-17)26-19(28)14-33-23-18(13-25)20(15-7-5-4-6-8-15)21(22(29)27-23)24(30)31-2/h4-12,20-21H,3,14H2,1-2H3,(H,26,28)(H,27,29)/t20-,21-/m1/s1 |
| InChIKey | QIDTVHJDZLYMPH-NHCUHLMSSA-N |
| XLogP | 3.19 |
| TPSA | 117.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|