C19H13ClN2O3 — CID 126141772
(4R)-2-amino-4-(3-chloro-4-prop-2-ynoxyphenyl)-7-hydroxy-4H-chromene-3-carbonitrile (PubChem CID 126141772) has the molecular formula C19H13ClN2O3 and a molecular weight of 352.78 g/mol. Its IUPAC name is (4R)-2-amino-4-(3-chloro-4-prop-2-ynoxyphenyl)-7-hydroxy-4H-chromene-3-carbonitrile.
| Compound Name | (4R)-2-amino-4-(3-chloro-4-prop-2-ynoxyphenyl)-7-hydroxy-4H-chromene-3-carbonitrile |
|---|---|
| PubChem CID | 126141772 |
| Molecular Formula | C19H13ClN2O3 |
| Molecular Weight | 352.78 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | (4R)-2-amino-4-(3-chloro-4-prop-2-ynoxyphenyl)-7-hydroxy-4H-chromene-3-carbonitrile |
| SMILES | C#CCOc1ccc([C@H]2C(C#N)=C(N)Oc3cc(O)ccc32)cc1Cl |
| InChI | InChI=1S/C19H13ClN2O3/c1-2-7-24-16-6-3-11(8-15(16)20)18-13-5-4-12(23)9-17(13)25-19(22)14(18)10-21/h1,3-6,8-9,18,23H,7,22H2/t18-/m1/s1 |
| InChIKey | RJZZBEGZBMZRLF-GOSISDBHSA-N |
| XLogP | 3.28 |
| TPSA | 88.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.78 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|