C21H16BrN5O4 — CID 126141830
(4S)-6-amino-4-[5-bromo-2-[(3-nitrophenyl)methoxy]phenyl]-3-methyl-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile (PubChem CID 126141830) has the molecular formula C21H16BrN5O4 and a molecular weight of 482.29 g/mol. Its IUPAC name is (4S)-6-amino-4-[5-bromo-2-[(3-nitrophenyl)methoxy]phenyl]-3-methyl-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile.
| Compound Name | (4S)-6-amino-4-[5-bromo-2-[(3-nitrophenyl)methoxy]phenyl]-3-methyl-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile |
|---|---|
| PubChem CID | 126141830 |
| Molecular Formula | C21H16BrN5O4 |
| Molecular Weight | 482.29 g/mol |
| Exact Mass | 481.04 |
| IUPAC Name | (4S)-6-amino-4-[5-bromo-2-[(3-nitrophenyl)methoxy]phenyl]-3-methyl-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile |
| SMILES | Cc1[nH]nc2c1[C@@H](c1cc(Br)ccc1OCc1cccc([N+](=O)[O-])c1)C(C#N)=C(N)O2 |
| InChI | InChI=1S/C21H16BrN5O4/c1-11-18-19(16(9-23)20(24)31-21(18)26-25-11)15-8-13(22)5-6-17(15)30-10-12-3-2-4-14(7-12)27(28)29/h2-8,19H,10,24H2,1H3,(H,25,26)/t19-/m0/s1 |
| InChIKey | QHGBQKZAUHVFON-IBGZPJMESA-N |
| XLogP | 4.19 |
| TPSA | 140.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.29 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|