C30H32N2O2S — CID 126142327
(5Z)-5-[[1-(4-cyclohexylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-3-(2-phenylethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 126142327) has the molecular formula C30H32N2O2S and a molecular weight of 484.67 g/mol. Its IUPAC name is (5Z)-5-[[1-(4-cyclohexylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-3-(2-phenylethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[1-(4-cyclohexylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-3-(2-phenylethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126142327 |
| Molecular Formula | C30H32N2O2S |
| Molecular Weight | 484.67 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | (5Z)-5-[[1-(4-cyclohexylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-3-(2-phenylethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1cc(/C=C2\SC(=O)N(CCc3ccccc3)C2=O)c(C)n1-c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C30H32N2O2S/c1-21-19-26(20-28-29(33)31(30(34)35-28)18-17-23-9-5-3-6-10-23)22(2)32(21)27-15-13-25(14-16-27)24-11-7-4-8-12-24/h3,5-6,9-10,13-16,19-20,24H,4,7-8,11-12,17-18H2,1-2H3/b28-20- |
| InChIKey | WAWXLKQRADBEGJ-RRAHZORUSA-N |
| XLogP | 7.42 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.67 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|