C20H25N3O5S — CID 126143054
N-[(Z)-1-(3,4-dimethoxyphenyl)propylideneamino]-4-[methyl(methylsulfonyl)amino]benzamide (PubChem CID 126143054) has the molecular formula C20H25N3O5S and a molecular weight of 419.50 g/mol. Its IUPAC name is N-[(Z)-1-(3,4-dimethoxyphenyl)propylideneamino]-4-[methyl(methylsulfonyl)amino]benzamide.
| Compound Name | N-[(Z)-1-(3,4-dimethoxyphenyl)propylideneamino]-4-[methyl(methylsulfonyl)amino]benzamide |
|---|---|
| PubChem CID | 126143054 |
| Molecular Formula | C20H25N3O5S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | N-[(Z)-1-(3,4-dimethoxyphenyl)propylideneamino]-4-[methyl(methylsulfonyl)amino]benzamide |
| SMILES | CC/C(=N/NC(=O)c1ccc(N(C)S(C)(=O)=O)cc1)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C20H25N3O5S/c1-6-17(15-9-12-18(27-3)19(13-15)28-4)21-22-20(24)14-7-10-16(11-8-14)23(2)29(5,25)26/h7-13H,6H2,1-5H3,(H,22,24)/b21-17- |
| InChIKey | VGDVDKGKRWHPAX-FXBPSFAMSA-N |
| XLogP | 2.64 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|