C14H24 — CID 12614321
2,2,6,8,8-pentamethylnona-3,4,5-triene (PubChem CID 12614321) has the molecular formula C14H24 and a molecular weight of 192.35 g/mol. Its IUPAC name is 2,2,6,8,8-pentamethylnona-3,4,5-triene.
| Compound Name | 2,2,6,8,8-pentamethylnona-3,4,5-triene |
|---|---|
| PubChem CID | 12614321 |
| Molecular Formula | C14H24 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.19 |
| IUPAC Name | 2,2,6,8,8-pentamethylnona-3,4,5-triene |
| SMILES | CC(=C=C=CC(C)(C)C)CC(C)(C)C |
| InChI | InChI=1S/C14H24/c1-12(11-14(5,6)7)9-8-10-13(2,3)4/h10H,11H2,1-7H3/b12-10+ |
| InChIKey | YBPNCJJFYRZYRN-ZRDIBKRKSA-N |
| XLogP | 4.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |