C19H17IN2O4 — CID 126143250
(4S)-2-amino-4-(4-ethoxy-3-iodo-5-methoxyphenyl)-7-hydroxy-4H-chromene-3-carbonitrile (PubChem CID 126143250) has the molecular formula C19H17IN2O4 and a molecular weight of 464.26 g/mol. Its IUPAC name is (4S)-2-amino-4-(4-ethoxy-3-iodo-5-methoxyphenyl)-7-hydroxy-4H-chromene-3-carbonitrile.
| Compound Name | (4S)-2-amino-4-(4-ethoxy-3-iodo-5-methoxyphenyl)-7-hydroxy-4H-chromene-3-carbonitrile |
|---|---|
| PubChem CID | 126143250 |
| Molecular Formula | C19H17IN2O4 |
| Molecular Weight | 464.26 g/mol |
| Exact Mass | 464.02 |
| IUPAC Name | (4S)-2-amino-4-(4-ethoxy-3-iodo-5-methoxyphenyl)-7-hydroxy-4H-chromene-3-carbonitrile |
| SMILES | CCOc1c(I)cc([C@@H]2C(C#N)=C(N)Oc3cc(O)ccc32)cc1OC |
| InChI | InChI=1S/C19H17IN2O4/c1-3-25-18-14(20)6-10(7-16(18)24-2)17-12-5-4-11(23)8-15(12)26-19(22)13(17)9-21/h4-8,17,23H,3,22H2,1-2H3/t17-/m0/s1 |
| InChIKey | UGHYYKVVWMAUMM-KRWDZBQOSA-N |
| XLogP | 3.62 |
| TPSA | 97.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.26 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|