C20H21IN2O4 — CID 126144852
(4R)-2-amino-4-(3,4-diethoxy-5-iodophenyl)-5-oxo-4,6,7,8-tetrahydrochromene-3-carbonitrile (PubChem CID 126144852) has the molecular formula C20H21IN2O4 and a molecular weight of 480.30 g/mol. Its IUPAC name is (4R)-2-amino-4-(3,4-diethoxy-5-iodophenyl)-5-oxo-4,6,7,8-tetrahydrochromene-3-carbonitrile.
| Compound Name | (4R)-2-amino-4-(3,4-diethoxy-5-iodophenyl)-5-oxo-4,6,7,8-tetrahydrochromene-3-carbonitrile |
|---|---|
| PubChem CID | 126144852 |
| Molecular Formula | C20H21IN2O4 |
| Molecular Weight | 480.30 g/mol |
| Exact Mass | 480.05 |
| IUPAC Name | (4R)-2-amino-4-(3,4-diethoxy-5-iodophenyl)-5-oxo-4,6,7,8-tetrahydrochromene-3-carbonitrile |
| SMILES | CCOc1cc([C@@H]2C(C#N)=C(N)OC3=C2C(=O)CCC3)cc(I)c1OCC |
| InChI | InChI=1S/C20H21IN2O4/c1-3-25-16-9-11(8-13(21)19(16)26-4-2)17-12(10-22)20(23)27-15-7-5-6-14(24)18(15)17/h8-9,17H,3-7,23H2,1-2H3/t17-/m1/s1 |
| InChIKey | DSRRRFADKIFCAJ-QGZVFWFLSA-N |
| XLogP | 3.90 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.30 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|