C19H30N2O4 — CID 126147164
N'-(4-pentoxyphenyl)-N-(3-propan-2-yloxypropyl)oxamide (PubChem CID 126147164) has the molecular formula C19H30N2O4 and a molecular weight of 350.46 g/mol. Its IUPAC name is N'-(4-pentoxyphenyl)-N-(3-propan-2-yloxypropyl)oxamide.
| Compound Name | N'-(4-pentoxyphenyl)-N-(3-propan-2-yloxypropyl)oxamide |
|---|---|
| PubChem CID | 126147164 |
| Molecular Formula | C19H30N2O4 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | N'-(4-pentoxyphenyl)-N-(3-propan-2-yloxypropyl)oxamide |
| SMILES | CCCCCOc1ccc(NC(=O)C(=O)NCCCOC(C)C)cc1 |
| InChI | InChI=1S/C19H30N2O4/c1-4-5-6-13-25-17-10-8-16(9-11-17)21-19(23)18(22)20-12-7-14-24-15(2)3/h8-11,15H,4-7,12-14H2,1-3H3,(H,20,22)(H,21,23) |
| InChIKey | SZMLHSPVVUUGFO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|