C24H25ClN2O3S — CID 126154684
2-[N-(benzenesulfonyl)-3-chloro-4-methylanilino]-N-(2-ethyl-6-methylphenyl)acetamide (PubChem CID 126154684) has the molecular formula C24H25ClN2O3S and a molecular weight of 457.00 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-3-chloro-4-methylanilino]-N-(2-ethyl-6-methylphenyl)acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-3-chloro-4-methylanilino]-N-(2-ethyl-6-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126154684 |
| Molecular Formula | C24H25ClN2O3S |
| Molecular Weight | 457.00 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-3-chloro-4-methylanilino]-N-(2-ethyl-6-methylphenyl)acetamide |
| SMILES | CCc1cccc(C)c1NC(=O)CN(c1ccc(C)c(Cl)c1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H25ClN2O3S/c1-4-19-10-8-9-18(3)24(19)26-23(28)16-27(20-14-13-17(2)22(25)15-20)31(29,30)21-11-6-5-7-12-21/h5-15H,4,16H2,1-3H3,(H,26,28) |
| InChIKey | YMBCWKFFKXREHY-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.00 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |