About 4-chloro-3-methylbuta-1,2-diene
4-chloro-3-methylbuta-1,2-diene (PubChem CID 12615574) has the molecular formula C5H7Cl
and a molecular weight of 102.56 g/mol. Its IUPAC name is 4-chloro-3-methylbuta-1,2-diene.
Molecular Properties
| Compound Name | 4-chloro-3-methylbuta-1,2-diene |
| PubChem CID | 12615574 |
| Molecular Formula | C5H7Cl |
| Molecular Weight | 102.56 g/mol |
| Exact Mass | 102.02 |
| IUPAC Name | 4-chloro-3-methylbuta-1,2-diene |
| SMILES | C=C=C(C)CCl |
| InChI | InChI=1S/C5H7Cl/c1-3-5(2)4-6/h1,4H2,2H3 |
| InChIKey | BGDIIQHCPUSXMC-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.56 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-3-methylbuta-1,2-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-3-methylbuta-1,2-diene?
The IUPAC name of 4-chloro-3-methylbuta-1,2-diene (CID 12615574) is 4-chloro-3-methylbuta-1,2-diene.
What is the SMILES notation for 4-chloro-3-methylbuta-1,2-diene?
The canonical SMILES for 4-chloro-3-methylbuta-1,2-diene is C=C=C(C)CCl.
What is the InChIKey of 4-chloro-3-methylbuta-1,2-diene?
The InChIKey is BGDIIQHCPUSXMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7Cl/c1-3-5(2)4-6/h1,4H2,2H3.
What are the key properties of 4-chloro-3-methylbuta-1,2-diene?
4-chloro-3-methylbuta-1,2-diene has a molecular weight of 102.56 g/mol, XLogP of 1.96, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-3-methylbuta-1,2-diene is sourced from PubChem (CID 12615574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).