C24H21NO3S — CID 126155945
(5S)-3-benzyl-5-[(2-phenylmethoxyphenyl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 126155945) has the molecular formula C24H21NO3S and a molecular weight of 403.50 g/mol. Its IUPAC name is (5S)-3-benzyl-5-[(2-phenylmethoxyphenyl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5S)-3-benzyl-5-[(2-phenylmethoxyphenyl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126155945 |
| Molecular Formula | C24H21NO3S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | (5S)-3-benzyl-5-[(2-phenylmethoxyphenyl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S[C@@H](Cc2ccccc2OCc2ccccc2)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C24H21NO3S/c26-23-22(29-24(27)25(23)16-18-9-3-1-4-10-18)15-20-13-7-8-14-21(20)28-17-19-11-5-2-6-12-19/h1-14,22H,15-17H2/t22-/m0/s1 |
| InChIKey | MOYYIXGUYPFHPV-QFIPXVFZSA-N |
| XLogP | 5.07 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|