C31H30N4O8S — CID 126156128
2-[(5E)-5-[[3-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-morpholin-4-ylphenyl)acetamide (PubChem CID 126156128) has the molecular formula C31H30N4O8S and a molecular weight of 618.67 g/mol. Its IUPAC name is 2-[(5E)-5-[[3-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[(5E)-5-[[3-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 126156128 |
| Molecular Formula | C31H30N4O8S |
| Molecular Weight | 618.67 g/mol |
| Exact Mass | 618.18 |
| IUPAC Name | 2-[(5E)-5-[[3-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-morpholin-4-ylphenyl)acetamide |
| SMILES | CCOc1cc(/C=C2/SC(=O)N(CC(=O)Nc3ccc(N4CCOCC4)cc3)C2=O)ccc1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C31H30N4O8S/c1-2-42-27-17-22(5-12-26(27)43-20-21-3-8-25(9-4-21)35(39)40)18-28-30(37)34(31(38)44-28)19-29(36)32-23-6-10-24(11-7-23)33-13-15-41-16-14-33/h3-12,17-18H,2,13-16,19-20H2,1H3,(H,32,36)/b28-18+ |
| InChIKey | SFWMYZCIWSRQLX-MTDXEUNCSA-N |
| XLogP | 5.08 |
| TPSA | 140.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.67 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|